propyl 3,4,5-trihydroxybenzoate

🙚 Home 🙚 Tables for Chemistry 🙘 Compound classes 🙘

propyl gallate; propyl 3,4,5-trihydroxybenzoate
Links:📏 NIST, 🕷 ChemSpider, 📖 PubMed
MeSH:Antioxidants; Protective Agents
CAS RN:[121-79-9]
Formula:C10H12O5; 212.20 g/mol
InChiKey:ZTHYODDOHIVTJV-UHFFFAOYSA-N
SMILES:CCCOC(=O)c1cc(O)c(O)c(O)c1
Molecular structure of propyl 3,4,5-trihydroxybenzoate
Toxicology (LD50):380 mg/Kg (rat, ip); 3 800 mg/Kg(rat, or)
Melting point:150 °C
Log10 partition octanol / water:1.80

Isomers

3,5-dimethoxy-4-hydroxyphenylacetic acid
Molecular structure of 3,5-dimethoxy-4-hydroxyphenylacetic acid
2,6-dimethoxyphenoxyacetic acid
Molecular structure of 2,6-dimethoxyphenoxyacetic acid
methyl 3,5-dimethoxy-4-hydroxybenzoate
Molecular structure of methyl 3,5-dimethoxy-4-hydroxybenzoate
propan-2-yl 3,4,5-trihydroxybenzoate
Molecular structure of propan-2-yl 3,4,5-trihydroxybenzoate
propyl 3,4,5-trihydroxybenzoate
Molecular structure of propyl 3,4,5-trihydroxybenzoate
2,3,4-trimethoxybenzoic acid
Molecular structure of 2,3,4-trimethoxybenzoic acid
2,4,5-trimethoxybenzoic acid
Molecular structure of 2,4,5-trimethoxybenzoic acid
2,4,6-trimethoxybenzoic acid
Molecular structure of 2,4,6-trimethoxybenzoic acid
3,4,5-trimethoxybenzoic acid
Molecular structure of 3,4,5-trimethoxybenzoic acid
  ::